Products 2123439-02-9
CAS 2123439-02-9 appears in our catalog under these names: L–Glutamine–13C5,15N2,d5, L-Glutamine-13C5,15N2,d5, 99.91%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 1 mg, 5 mg, 10 mg.
(2S)-2,5-bis(15N)(azanyl)-2,3,3,4,4-pentadeuterio-5-oxo(1,2,3,4,5-13C5)pentanoic acid (CAS 2123439-02-9) is a chemical compound with the molecular formula C5H10N2O3 and a molecular weight of 158.126 g/mol. IUPAC name: (2S)-2,5-bis(15N)(azanyl)-2,3,3,4,4-pentadeuterio-5-oxo(1,2,3,4,5-13C5)pentanoic acid. InChIKey: ZDXPYRJPNDTMRX-GTWFMKDCSA-N.
| Molecular formula | C5H10N2O3 |
|---|---|
| Molecular weight | 158.126 g/mol |
| IUPAC name | (2S)-2,5-bis(15N)(azanyl)-2,3,3,4,4-pentadeuterio-5-oxo(1,2,3,4,5-13C5)pentanoic acid |
| InChIKey | ZDXPYRJPNDTMRX-GTWFMKDCSA-N |
| SMILES | [2H][13C@@]([13C](=O)O)([13C]([2H])([2H])[13C]([2H])([2H])[13C](=O)[15NH2])[15NH2] |
Computed by PubChem (NCBI)