Products 2126161-19-9
CAS 2126161-19-9 is the registry number for 7-Chloro-8-methoxy-2,3,4,5-tetrahydro-1H-pyrido(4,3-b)indole hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
7-chloro-8-methoxy-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole;hydrochloride (CAS 2126161-19-9) is a chemical compound with the molecular formula C12H14Cl2N2O and a molecular weight of 273.15 g/mol. IUPAC name: 7-chloro-8-methoxy-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole;hydrochloride. InChIKey: SXVXOSDNEJTRIX-UHFFFAOYSA-N.
| Molecular formula | C12H14Cl2N2O |
|---|---|
| Molecular weight | 273.15 g/mol |
| IUPAC name | 7-chloro-8-methoxy-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole;hydrochloride |
| InChIKey | SXVXOSDNEJTRIX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C3=C(N2)CCNC3)Cl.Cl |
Computed by PubChem (NCBI)