CAS 2126161-81-5 appears in our catalog under these names: Methyl 5,6-dihydro-4H-thieno(2,3-c)pyrrole-2-carboxylate hydrochloride, 95%, Methyl 4H,5H,6H-thieno(2,3-c)pyrrole-2-carboxylate hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Methyl 5,6-dihydro-4H-thieno[2,3-c]pyrrole-2-carboxylate;hydrochloride (CAS 2126161-81-5) is a chemical compound with the molecular formula C8H10ClNO2S and a molecular weight of 219.69 g/mol. IUPAC name: methyl 5,6-dihydro-4H-thieno[2,3-c]pyrrole-2-carboxylate;hydrochloride. InChIKey: IGWNXOVWWALERT-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO2S |
|---|---|
| Molecular weight | 219.69 g/mol |
| IUPAC name | methyl 5,6-dihydro-4H-thieno[2,3-c]pyrrole-2-carboxylate;hydrochloride |
| InChIKey | IGWNXOVWWALERT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(S1)CNC2.Cl |
Computed by PubChem (NCBI)