CAS 21262-06-6 is the registry number for 2-Chloro-n-(3-chlorophenyl)propanamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-chloro-N-(3-chlorophenyl)propanamide (CAS 21262-06-6) is a chemical compound with the molecular formula C9H9Cl2NO and a molecular weight of 218.08 g/mol. IUPAC name: 2-chloro-N-(3-chlorophenyl)propanamide. InChIKey: RMICMLBMAQRUJI-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO |
|---|---|
| Molecular weight | 218.08 g/mol |
| IUPAC name | 2-chloro-N-(3-chlorophenyl)propanamide |
| InChIKey | RMICMLBMAQRUJI-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=CC(=CC=C1)Cl)Cl |
Computed by PubChem (NCBI)