CAS 212650-43-6 appears in our catalog under these names: 4–Boc–3–morpholinecarboxylic Acid, 4-Boc-3-Morpholinecarboxylic acid, 98%, 98%, Morpholine-3,4-dicarboxylic acid 4-tert-butylester, 97%, 4-Boc-3-Morpholinecarboxylic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 250mg, 1g, 10g, 25g, 100g, 250g, 500g.
4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-3-carboxylic acid (CAS 212650-43-6) is a chemical compound with the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. IUPAC name: 4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-3-carboxylic acid. InChIKey: KVXXEKIGMOEPSA-UHFFFAOYSA-N.
| Molecular formula | C10H17NO5 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | 4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-3-carboxylic acid |
| InChIKey | KVXXEKIGMOEPSA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOCC1C(=O)O |
Computed by PubChem (NCBI)