CAS 869681-70-9 appears in our catalog under these names: (R)-4-(tert-Butoxycarbonyl)morpholine-3-carboxylic acid, 95%, Boc-Morpholine-3-COOH (R), (R)-4-Boc-morpholine-3-carboxylic acid, 97% , (R)-4-(tert-Butoxycarbonyl)morpholine-3-carboxylic acid 98+%, (R)-4-Boc-morpholine-3-carboxylic Acid, 97%, 97%. Offered by: AmBeed, Iris Biotech, Thermo Scientific (Alfa Aesar), Chemat, Fluorochem. Available pack sizes: 10g, 100mg, 5g, 25g, 1g, 250mg, 100g.
(3R)-4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-3-carboxylic acid (CAS 869681-70-9) is a chemical compound with the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. IUPAC name: (3R)-4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-3-carboxylic acid. InChIKey: KVXXEKIGMOEPSA-SSDOTTSWSA-N.
| Molecular formula | C10H17NO5 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | (3R)-4-[(2-methylpropan-2-yl)oxycarbonyl]morpholine-3-carboxylic acid |
| InChIKey | KVXXEKIGMOEPSA-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOC[C@@H]1C(=O)O |
Computed by PubChem (NCBI)