Products 21282-16-6
CAS 21282-16-6 appears in our catalog under these names: Pidotimod Impurity 38, (2R)-2-{((2S)-5-Oxopyrrolidin-2-yl)formamido}propanoic acid. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 0,5g, 50mg.
(2R)-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]propanoic acid (CAS 21282-16-6) is a chemical compound with the molecular formula C8H12N2O4 and a molecular weight of 200.19 g/mol. IUPAC name: (2R)-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]propanoic acid. InChIKey: YIJVJUARZXCJJP-UHNVWZDZSA-N.
| Molecular formula | C8H12N2O4 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | (2R)-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]propanoic acid |
| InChIKey | YIJVJUARZXCJJP-UHNVWZDZSA-N |
| SMILES | C[C@H](C(=O)O)NC(=O)[C@@H]1CCC(=O)N1 |
Computed by PubChem (NCBI)