Products 2131740-88-8
CAS 2131740-88-8 is the registry number for (E)-3-(2,4-Bis(trifluoromethyl)phenyl)acrylic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(E)-3-[2,4-bis(trifluoromethyl)phenyl]prop-2-enoic acid (CAS 2131740-88-8) is a chemical compound with the molecular formula C11H6F6O2 and a molecular weight of 284.15 g/mol. IUPAC name: (E)-3-[2,4-bis(trifluoromethyl)phenyl]prop-2-enoic acid. InChIKey: YGAXXKKVJARVCF-DUXPYHPUSA-N.
| Molecular formula | C11H6F6O2 |
|---|---|
| Molecular weight | 284.15 g/mol |
| IUPAC name | (E)-3-[2,4-bis(trifluoromethyl)phenyl]prop-2-enoic acid |
| InChIKey | YGAXXKKVJARVCF-DUXPYHPUSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C(F)(F)F)/C=C/C(=O)O |
Computed by PubChem (NCBI)