CAS 213381-49-8 is the registry number for 7–Bromo–2–isopropyl–2,3–dihydro–1H–inden–1–one. Offered by: GLPBio. Available pack sizes: 1g.
7-bromo-2-propan-2-yl-2,3-dihydroinden-1-one (CAS 213381-49-8) is a chemical compound with the molecular formula C12H13BrO and a molecular weight of 253.13 g/mol. IUPAC name: 7-bromo-2-propan-2-yl-2,3-dihydroinden-1-one. InChIKey: IFVOQEPLOBCNDG-UHFFFAOYSA-N.
| Molecular formula | C12H13BrO |
|---|---|
| Molecular weight | 253.13 g/mol |
| IUPAC name | 7-bromo-2-propan-2-yl-2,3-dihydroinden-1-one |
| InChIKey | IFVOQEPLOBCNDG-UHFFFAOYSA-N |
| SMILES | CC(C)C1CC2=C(C1=O)C(=CC=C2)Br |
Computed by PubChem (NCBI)