CAS 21346-21-4 is the registry number for 3-(4-Hydroxyphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-(4-hydroxyphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one (CAS 21346-21-4) is a chemical compound with the molecular formula C9H7NO2S2 and a molecular weight of 225.3 g/mol. IUPAC name: 3-(4-hydroxyphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one. InChIKey: YUUFJQSSWHKSBR-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2S2 |
|---|---|
| Molecular weight | 225.3 g/mol |
| IUPAC name | 3-(4-hydroxyphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| InChIKey | YUUFJQSSWHKSBR-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C(=S)S1)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)