CAS 2137135-65-8 appears in our catalog under these names: N-(((9H-Fluoren-9-yl)methoxy)carbonyl)-N-benzyl-D-alanine, 95%, (2R)-2-(Benzyl({((9H-fluoren-9-yl)methoxy)carbonyl})amino)propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
(2R)-2-[benzyl(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid (CAS 2137135-65-8) is a chemical compound with the molecular formula C25H23NO4 and a molecular weight of 401.5 g/mol. IUPAC name: (2R)-2-[benzyl(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid. InChIKey: QFVKHZGPQOFFBR-QGZVFWFLSA-N.
| Molecular formula | C25H23NO4 |
|---|---|
| Molecular weight | 401.5 g/mol |
| IUPAC name | (2R)-2-[benzyl(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid |
| InChIKey | QFVKHZGPQOFFBR-QGZVFWFLSA-N |
| SMILES | C[C@H](C(=O)O)N(CC1=CC=CC=C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)