Products 540483-59-8

CAS 540483-59-8 is the registry number for 2-{benzyl((9H-fluoren-9-ylmethoxy)carbonyl)amino}propanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

2-[benzyl(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid (CAS 540483-59-8) is a chemical compound with the molecular formula C25H23NO4 and a molecular weight of 401.5 g/mol. IUPAC name: 2-[benzyl(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid. InChIKey: QFVKHZGPQOFFBR-UHFFFAOYSA-N.

Identity
Molecular formulaC25H23NO4
Molecular weight401.5 g/mol
IUPAC name2-[benzyl(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid
InChIKeyQFVKHZGPQOFFBR-UHFFFAOYSA-N
SMILESCC(C(=O)O)N(CC1=CC=CC=C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24

Computed by PubChem (NCBI)