CAS 2137594-92-2 is the registry number for 8-Aminoquinoline-6-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
8-aminoquinoline-6-carboxylic acid;hydrochloride (CAS 2137594-92-2) is a chemical compound with the molecular formula C10H9ClN2O2 and a molecular weight of 224.64 g/mol. IUPAC name: 8-aminoquinoline-6-carboxylic acid;hydrochloride. InChIKey: RXOBRHWOVXKKKD-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O2 |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | 8-aminoquinoline-6-carboxylic acid;hydrochloride |
| InChIKey | RXOBRHWOVXKKKD-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CC(=C2N=C1)N)C(=O)O.Cl |
Computed by PubChem (NCBI)