CAS 2137599-70-1 is the registry number for 5-(Aminomethyl)-1-(tert-butyl)pyrimidine-2,4(1H,3H)-dione hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 5g.
5-(aminomethyl)-1-tert-butylpyrimidine-2,4-dione;hydrochloride (CAS 2137599-70-1) is a chemical compound with the molecular formula C9H16ClN3O2 and a molecular weight of 233.69 g/mol. IUPAC name: 5-(aminomethyl)-1-tert-butylpyrimidine-2,4-dione;hydrochloride. InChIKey: XISQKYJUQNTRJQ-UHFFFAOYSA-N.
| Molecular formula | C9H16ClN3O2 |
|---|---|
| Molecular weight | 233.69 g/mol |
| IUPAC name | 5-(aminomethyl)-1-tert-butylpyrimidine-2,4-dione;hydrochloride |
| InChIKey | XISQKYJUQNTRJQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C=C(C(=O)NC1=O)CN.Cl |
Computed by PubChem (NCBI)