Products 2892290-69-4
CAS 2892290-69-4 is the registry number for (S)-2-Amino-3-((R)-5-oxo-4-azaspiro[2.4]heptan-6-yl)propanamide hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-3-[(6R)-5-oxo-4-azaspiro[2.4]heptan-6-yl]propanamide;hydrochloride (CAS 2892290-69-4) is a chemical compound with the molecular formula C9H16ClN3O2 and a molecular weight of 233.69 g/mol. IUPAC name: (2S)-2-amino-3-[(6R)-5-oxo-4-azaspiro[2.4]heptan-6-yl]propanamide;hydrochloride. InChIKey: AYVKHVKVNNNLGB-IBTYICNHSA-N.
| Molecular formula | C9H16ClN3O2 |
|---|---|
| Molecular weight | 233.69 g/mol |
| IUPAC name | (2S)-2-amino-3-[(6R)-5-oxo-4-azaspiro[2.4]heptan-6-yl]propanamide;hydrochloride |
| InChIKey | AYVKHVKVNNNLGB-IBTYICNHSA-N |
| SMILES | C1CC12C[C@H](C(=O)N2)C[C@@H](C(=O)N)N.Cl |
Computed by PubChem (NCBI)