CAS 1779128-57-2 is the registry number for 3-(propan-2-yl)-1,3,7-triazaspiro(4.4)nonane-2,4-dione hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g, 10g, 5g.
3-propan-2-yl-1,3,7-triazaspiro[4.4]nonane-2,4-dione;hydrochloride (CAS 1779128-57-2) is a chemical compound with the molecular formula C9H16ClN3O2 and a molecular weight of 233.69 g/mol. IUPAC name: 3-propan-2-yl-1,3,7-triazaspiro[4.4]nonane-2,4-dione;hydrochloride. InChIKey: NBPQLKUYPUUUNP-UHFFFAOYSA-N.
| Molecular formula | C9H16ClN3O2 |
|---|---|
| Molecular weight | 233.69 g/mol |
| IUPAC name | 3-propan-2-yl-1,3,7-triazaspiro[4.4]nonane-2,4-dione;hydrochloride |
| InChIKey | NBPQLKUYPUUUNP-UHFFFAOYSA-N |
| SMILES | CC(C)N1C(=O)C2(CCNC2)NC1=O.Cl |
Computed by PubChem (NCBI)