CAS 1206970-39-9 appears in our catalog under these names: 1,3-Dimethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione hydrochloride, 95%, 1,3–dimethyl–1,3,8–triazaspiro(4·5)decane–2,4–dione hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g.
1,3-dimethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione;hydrochloride (CAS 1206970-39-9) is a chemical compound with the molecular formula C9H16ClN3O2 and a molecular weight of 233.69 g/mol. IUPAC name: 1,3-dimethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione;hydrochloride. InChIKey: AJRHDTGMALYLNR-UHFFFAOYSA-N.
| Molecular formula | C9H16ClN3O2 |
|---|---|
| Molecular weight | 233.69 g/mol |
| IUPAC name | 1,3-dimethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione;hydrochloride |
| InChIKey | AJRHDTGMALYLNR-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C2(CCNCC2)N(C1=O)C.Cl |
Computed by PubChem (NCBI)