Products 54749-91-6

CAS 54749-91-6 is the registry number for Lomustine Impurity 4(Lomustine USP RC D). Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

3-(2-chloroethyl)-1-cyclohexyl-1-nitrosourea (CAS 54749-91-6) is a chemical compound with the molecular formula C9H16ClN3O2 and a molecular weight of 233.69 g/mol. IUPAC name: 3-(2-chloroethyl)-1-cyclohexyl-1-nitrosourea. InChIKey: IGMMTYZWNUSEEU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H16ClN3O2
Molecular weight233.69 g/mol
IUPAC name3-(2-chloroethyl)-1-cyclohexyl-1-nitrosourea
InChIKeyIGMMTYZWNUSEEU-UHFFFAOYSA-N
SMILESC1CCC(CC1)N(C(=O)NCCCl)N=O

Computed by PubChem (NCBI)