Products 1346603-97-1
CAS 1346603-97-1 appears in our catalog under these names: N-Denitroso-N’-nitroso Lomustine-d4, N-Denitroso-N-nitroso lomustine-d4. Offered by: TRC, Biosynth. Available pack sizes: 25mg, 1mg, 5mg, 10mg, 50mg.
3-(2-chloro-1,1,2,2-tetradeuterioethyl)-1-cyclohexyl-1-nitrosourea (CAS 1346603-97-1) is a chemical compound with the molecular formula C9H16ClN3O2 and a molecular weight of 237.72 g/mol. IUPAC name: 3-(2-chloro-1,1,2,2-tetradeuterioethyl)-1-cyclohexyl-1-nitrosourea. InChIKey: IGMMTYZWNUSEEU-KXGHAPEVSA-N.
| Molecular formula | C9H16ClN3O2 |
|---|---|
| Molecular weight | 237.72 g/mol |
| IUPAC name | 3-(2-chloro-1,1,2,2-tetradeuterioethyl)-1-cyclohexyl-1-nitrosourea |
| InChIKey | IGMMTYZWNUSEEU-KXGHAPEVSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])Cl)NC(=O)N(C1CCCCC1)N=O |
Computed by PubChem (NCBI)