CAS 1803586-91-5 appears in our catalog under these names: 3-(3-(Propan-2-yl)-1,2,4-oxadiazol-5-yl)pyrrolidin-3-ol hydrochloride, 95%, 3-(3-(Propan-2-yl)-1,2,4-oxadiazol-5-yl)pyrrolidin-3-ol hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)pyrrolidin-3-ol;hydrochloride (CAS 1803586-91-5) is a chemical compound with the molecular formula C9H16ClN3O2 and a molecular weight of 233.69 g/mol. IUPAC name: 3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)pyrrolidin-3-ol;hydrochloride. InChIKey: WRISWZQRJQULHY-UHFFFAOYSA-N.
| Molecular formula | C9H16ClN3O2 |
|---|---|
| Molecular weight | 233.69 g/mol |
| IUPAC name | 3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)pyrrolidin-3-ol;hydrochloride |
| InChIKey | WRISWZQRJQULHY-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NOC(=N1)C2(CCNC2)O.Cl |
Computed by PubChem (NCBI)