Products 2137696-67-2
CAS 2137696-67-2 is the registry number for tert-Butyl 2,3-diazabicyclo(2.2.1)heptane-2-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl 2,3-diazabicyclo[2.2.1]heptane-2-carboxylate;hydrochloride (CAS 2137696-67-2) is a chemical compound with the molecular formula C10H19ClN2O2 and a molecular weight of 234.72 g/mol. IUPAC name: tert-butyl 2,3-diazabicyclo[2.2.1]heptane-2-carboxylate;hydrochloride. InChIKey: YAHZIKFHZPAATN-UHFFFAOYSA-N.
| Molecular formula | C10H19ClN2O2 |
|---|---|
| Molecular weight | 234.72 g/mol |
| IUPAC name | tert-butyl 2,3-diazabicyclo[2.2.1]heptane-2-carboxylate;hydrochloride |
| InChIKey | YAHZIKFHZPAATN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2CCC(C2)N1.Cl |
Computed by PubChem (NCBI)