CAS 2137936-30-0 is the registry number for (3-Nitrophenyl)methanesulfonyl fluoride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(3-nitrophenyl)methanesulfonyl fluoride (CAS 2137936-30-0) is a chemical compound with the molecular formula C7H6FNO4S and a molecular weight of 219.19 g/mol. IUPAC name: (3-nitrophenyl)methanesulfonyl fluoride. InChIKey: NEHJHAMCKIXOQT-UHFFFAOYSA-N.
| Molecular formula | C7H6FNO4S |
|---|---|
| Molecular weight | 219.19 g/mol |
| IUPAC name | (3-nitrophenyl)methanesulfonyl fluoride |
| InChIKey | NEHJHAMCKIXOQT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])CS(=O)(=O)F |
Computed by PubChem (NCBI)