Products 2137981-17-8
CAS 2137981-17-8 is the registry number for 1-(3-Hydroxypiperidin-3-yl)cyclobutane-1-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(3-hydroxypiperidin-3-yl)cyclobutane-1-carboxylic acid;hydrochloride (CAS 2137981-17-8) is a chemical compound with the molecular formula C10H18ClNO3 and a molecular weight of 235.71 g/mol. IUPAC name: 1-(3-hydroxypiperidin-3-yl)cyclobutane-1-carboxylic acid;hydrochloride. InChIKey: WYNDENILXUFBLI-UHFFFAOYSA-N.
| Molecular formula | C10H18ClNO3 |
|---|---|
| Molecular weight | 235.71 g/mol |
| IUPAC name | 1-(3-hydroxypiperidin-3-yl)cyclobutane-1-carboxylic acid;hydrochloride |
| InChIKey | WYNDENILXUFBLI-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C(=O)O)C2(CCCNC2)O.Cl |
Computed by PubChem (NCBI)