Products 2138012-25-4
CAS 2138012-25-4 is the registry number for rac-(3R,4R)-1-((tert-Butoxy)carbonyl)-4-propylpyrrolidine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(3S,4S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-propylpyrrolidine-3-carboxylic acid (CAS 2138012-25-4) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: (3S,4S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-propylpyrrolidine-3-carboxylic acid. InChIKey: IJSDVUAEMLGTBI-NXEZZACHSA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | (3S,4S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-propylpyrrolidine-3-carboxylic acid |
| InChIKey | IJSDVUAEMLGTBI-NXEZZACHSA-N |
| SMILES | CCC[C@@H]1CN(C[C@H]1C(=O)O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)