Products 2138038-56-7

CAS 2138038-56-7 is the registry number for tert-Butyl N-{3-hydroxy-7-oxaspiro(3.5)nonan-1-yl}carbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-(3-hydroxy-7-oxaspiro[3.5]nonan-1-yl)carbamate (CAS 2138038-56-7) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: tert-butyl N-(3-hydroxy-7-oxaspiro[3.5]nonan-1-yl)carbamate. InChIKey: HMHYBCRJLNPUMK-UHFFFAOYSA-N.

Identity
Molecular formulaC13H23NO4
Molecular weight257.33 g/mol
IUPAC nametert-butyl N-(3-hydroxy-7-oxaspiro[3.5]nonan-1-yl)carbamate
InChIKeyHMHYBCRJLNPUMK-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1CC(C12CCOCC2)O

Computed by PubChem (NCBI)