Products 2138085-74-0
CAS 2138085-74-0 is the registry number for 1,1,1-Trifluoro-2-methyl-3-phenylpropan-2-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1,1,1-trifluoro-2-methyl-3-phenylpropan-2-amine;hydrochloride (CAS 2138085-74-0) is a chemical compound with the molecular formula C10H13ClF3N and a molecular weight of 239.66 g/mol. IUPAC name: 1,1,1-trifluoro-2-methyl-3-phenylpropan-2-amine;hydrochloride. InChIKey: LRJNFWNJPYAGRW-UHFFFAOYSA-N.
| Molecular formula | C10H13ClF3N |
|---|---|
| Molecular weight | 239.66 g/mol |
| IUPAC name | 1,1,1-trifluoro-2-methyl-3-phenylpropan-2-amine;hydrochloride |
| InChIKey | LRJNFWNJPYAGRW-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC=CC=C1)(C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)