Products 2138134-58-2
CAS 2138134-58-2 is the registry number for 2-​Thiaspiro(3.5)​nonan-​7-​amine 2,​2-​dioxide hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,2-dioxo-2lambda6-thiaspiro[3.5]nonan-7-amine;hydrochloride (CAS 2138134-58-2) is a chemical compound with the molecular formula C8H16ClNO2S and a molecular weight of 225.74 g/mol. IUPAC name: 2,2-dioxo-2lambda6-thiaspiro[3.5]nonan-7-amine;hydrochloride. InChIKey: CRUVLUJLXGSVSN-UHFFFAOYSA-N.
| Molecular formula | C8H16ClNO2S |
|---|---|
| Molecular weight | 225.74 g/mol |
| IUPAC name | 2,2-dioxo-2lambda6-thiaspiro[3.5]nonan-7-amine;hydrochloride |
| InChIKey | CRUVLUJLXGSVSN-UHFFFAOYSA-N |
| SMILES | C1CC2(CCC1N)CS(=O)(=O)C2.Cl |
Computed by PubChem (NCBI)