Products 2138198-21-5
CAS 2138198-21-5 is the registry number for Methyl 2-(4'-vinyl-[1,1'-biphenyl]-4-yl)acetate, 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
Methyl 2-[4-(4-ethenylphenyl)phenyl]acetate (CAS 2138198-21-5) is a chemical compound with the molecular formula C17H16O2 and a molecular weight of 252.31 g/mol. IUPAC name: methyl 2-[4-(4-ethenylphenyl)phenyl]acetate. InChIKey: PDXAOFRIKYMAHK-UHFFFAOYSA-N.
| Molecular formula | C17H16O2 |
|---|---|
| Molecular weight | 252.31 g/mol |
| IUPAC name | methyl 2-[4-(4-ethenylphenyl)phenyl]acetate |
| InChIKey | PDXAOFRIKYMAHK-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC=C(C=C1)C2=CC=C(C=C2)C=C |
Computed by PubChem (NCBI)