Products 2138199-74-1
CAS 2138199-74-1 is the registry number for 3-Phenyl-5H,6H,8H-imidazo(4,3-c)(1,4)oxazine-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-phenyl-6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazine-1-carboxylic acid (CAS 2138199-74-1) is a chemical compound with the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. IUPAC name: 3-phenyl-6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazine-1-carboxylic acid. InChIKey: SMOMONDAXIUQRC-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O3 |
|---|---|
| Molecular weight | 244.25 g/mol |
| IUPAC name | 3-phenyl-6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazine-1-carboxylic acid |
| InChIKey | SMOMONDAXIUQRC-UHFFFAOYSA-N |
| SMILES | C1COCC2=C(N=C(N21)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)