Products 2138521-35-2
CAS 2138521-35-2 is the registry number for Ethyl 5-amino-2-chlorobenzoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Ethyl 5-amino-2-chlorobenzoate;hydrochloride (CAS 2138521-35-2) is a chemical compound with the molecular formula C9H11Cl2NO2 and a molecular weight of 236.09 g/mol. IUPAC name: ethyl 5-amino-2-chlorobenzoate;hydrochloride. InChIKey: RCJSZUCODVPWPA-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2NO2 |
|---|---|
| Molecular weight | 236.09 g/mol |
| IUPAC name | ethyl 5-amino-2-chlorobenzoate;hydrochloride |
| InChIKey | RCJSZUCODVPWPA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1)N)Cl.Cl |
Computed by PubChem (NCBI)