CAS 2138564-14-2 is the registry number for 3,4-Dichloro-N-(cyclopropylmethyl)aniline hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3,4-dichloro-N-(cyclopropylmethyl)aniline;hydrochloride (CAS 2138564-14-2) is a chemical compound with the molecular formula C10H12Cl3N and a molecular weight of 252.6 g/mol. IUPAC name: 3,4-dichloro-N-(cyclopropylmethyl)aniline;hydrochloride. InChIKey: BXIFIFFIIAHNBC-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl3N |
|---|---|
| Molecular weight | 252.6 g/mol |
| IUPAC name | 3,4-dichloro-N-(cyclopropylmethyl)aniline;hydrochloride |
| InChIKey | BXIFIFFIIAHNBC-UHFFFAOYSA-N |
| SMILES | C1CC1CNC2=CC(=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)