Products 2138565-28-1
CAS 2138565-28-1 is the registry number for 4,5,6,7-Tetrahydro-1H-indazole-7-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4,5,6,7-tetrahydro-1H-indazole-7-carboxylic acid;hydrochloride (CAS 2138565-28-1) is a chemical compound with the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. IUPAC name: 4,5,6,7-tetrahydro-1H-indazole-7-carboxylic acid;hydrochloride. InChIKey: MNLAJPGHCKCKDX-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O2 |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | 4,5,6,7-tetrahydro-1H-indazole-7-carboxylic acid;hydrochloride |
| InChIKey | MNLAJPGHCKCKDX-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C=NN2)C(=O)O.Cl |
Computed by PubChem (NCBI)