CAS 21388-97-6 is the registry number for 3-Nitrobenzyl acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(3-nitrophenyl)methyl acetate (CAS 21388-97-6) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: (3-nitrophenyl)methyl acetate. InChIKey: WNVPZUAAKWXDNS-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | (3-nitrophenyl)methyl acetate |
| InChIKey | WNVPZUAAKWXDNS-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC1=CC(=CC=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)