Products 2140327-01-9

CAS 2140327-01-9 is the registry number for 3-Bromo-4-(methoxy-d3)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-bromo-4-(trideuteriomethoxy)benzoic acid (CAS 2140327-01-9) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 234.06 g/mol. IUPAC name: 3-bromo-4-(trideuteriomethoxy)benzoic acid. InChIKey: BBPZABXVRBFWGD-FIBGUPNXSA-N.

Identity
Molecular formulaC8H7BrO3
Molecular weight234.06 g/mol
IUPAC name3-bromo-4-(trideuteriomethoxy)benzoic acid
InChIKeyBBPZABXVRBFWGD-FIBGUPNXSA-N
SMILES[2H]C([2H])([2H])OC1=C(C=C(C=C1)C(=O)O)Br

Computed by PubChem (NCBI)