CAS 99-58-1 appears in our catalog under these names: 3-Bromo-4-methoxybenzoic Acid, >95% (HPLC), 3-Bromo-4-methoxybenzoic acid/ 98+%, 3–Bromo–4–methoxybenzoic Acid, 3-Bromo-4-methoxybenzoic acid, 98+% , 3-Bromo-4-methoxybenzoic acid. Offered by: TRC, Chemat, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 10g, 25g, 5g, 100g, 250g, 500g, 1g, 50g.
3-bromo-4-methoxybenzoic acid (CAS 99-58-1) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: 3-bromo-4-methoxybenzoic acid. InChIKey: BBPZABXVRBFWGD-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | 3-bromo-4-methoxybenzoic acid |
| InChIKey | BBPZABXVRBFWGD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)O)Br |
Computed by PubChem (NCBI)