Products 2140327-49-5
CAS 2140327-49-5 appears in our catalog under these names: Chlorpropham-d7 (iso-propyl-d7), 99 atom % D, min 98% Chemical Purity, Chlorpropham-d7, 99%. Offered by: CDN, MedChemExpress. Available pack sizes: 0,01g, 0,005g, 1 mg, 5 mg.
1,1,1,2,3,3,3-heptadeuteriopropan-2-yl N-(3-chlorophenyl)carbamate (CAS 2140327-49-5) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 220.70 g/mol. IUPAC name: 1,1,1,2,3,3,3-heptadeuteriopropan-2-yl N-(3-chlorophenyl)carbamate. InChIKey: CWJSHJJYOPWUGX-QXMYYZBZSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 220.70 g/mol |
| IUPAC name | 1,1,1,2,3,3,3-heptadeuteriopropan-2-yl N-(3-chlorophenyl)carbamate |
| InChIKey | CWJSHJJYOPWUGX-QXMYYZBZSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])OC(=O)NC1=CC(=CC=C1)Cl |
Computed by PubChem (NCBI)