Products 214262-97-2
CAS 214262-97-2 is the registry number for 1-(3-Fluorophenyl)cyclopentanecarboxylic acid, 98%. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
1-(3-fluorophenyl)cyclopentane-1-carboxylic acid (CAS 214262-97-2) is a chemical compound with the molecular formula C12H13FO2 and a molecular weight of 208.23 g/mol. IUPAC name: 1-(3-fluorophenyl)cyclopentane-1-carboxylic acid. InChIKey: RLAKVCCLVVITLS-UHFFFAOYSA-N.
| Molecular formula | C12H13FO2 |
|---|---|
| Molecular weight | 208.23 g/mol |
| IUPAC name | 1-(3-fluorophenyl)cyclopentane-1-carboxylic acid |
| InChIKey | RLAKVCCLVVITLS-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC(=CC=C2)F)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
1-(3-fluorophenyl)cyclopentanecarboxylic acid, 1-(3-fluorophenyl)cyclopentane-1-carboxylic Acid, 1-(3-Fluorophenyl)cyclophentanecarboxylic acid, Cyclopentanecarboxylic acid, 1-(3-fluorophenyl)-, 1-(3-Fluorophenyl)cyclopentanecarboxylic acid, 98% 5GR, 1-(3-Fluorophenyl)cyclopentanecarboxylic acid - [F93053]