CAS 214360-66-4 appears in our catalog under these names: 2-(4-(tert-Butyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98%, 2-(4-tert-Butylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 2-(4-(tert-Butyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g.
2-(4-tert-butylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 214360-66-4) is a chemical compound with the molecular formula C16H25BO2 and a molecular weight of 260.2 g/mol. IUPAC name: 2-(4-tert-butylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: SAWJXFQIAPLBEA-UHFFFAOYSA-N.
| Molecular formula | C16H25BO2 |
|---|---|
| Molecular weight | 260.2 g/mol |
| IUPAC name | 2-(4-tert-butylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | SAWJXFQIAPLBEA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(C)(C)C |
Computed by PubChem (NCBI)