CAS 2143878-49-1 appears in our catalog under these names: 2,4,6-Trichloropyrido(3,4-d)pyrimidine, 2,4,6-Trichloropyrido[3,4-d]pyrimidine, 96%, 96%, 2,4,6-Trichloropyrido[3,4-d]pyrimidine, 96%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 25mg.
2,4,6-trichloropyrido[3,4-d]pyrimidine (CAS 2143878-49-1) is a chemical compound with the molecular formula C7H2Cl3N3 and a molecular weight of 234.5 g/mol. IUPAC name: 2,4,6-trichloropyrido[3,4-d]pyrimidine. InChIKey: PRLOEVRFKDKTKT-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl3N3 |
|---|---|
| Molecular weight | 234.5 g/mol |
| IUPAC name | 2,4,6-trichloropyrido[3,4-d]pyrimidine |
| InChIKey | PRLOEVRFKDKTKT-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CN=C1Cl)N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)