Products 2144478-62-4
CAS 2144478-62-4 is the registry number for tert-Butyl (3-aminobicyclo[1.1.1]pentan-1-yl)carbamate hydrochloride, 97%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl N-(3-amino-1-bicyclo[1.1.1]pentanyl)carbamate;hydrochloride (CAS 2144478-62-4) is a chemical compound with the molecular formula C10H19ClN2O2 and a molecular weight of 234.72 g/mol. IUPAC name: tert-butyl N-(3-amino-1-bicyclo[1.1.1]pentanyl)carbamate;hydrochloride. InChIKey: JLRXEAFTXRCHPR-UHFFFAOYSA-N.
| Molecular formula | C10H19ClN2O2 |
|---|---|
| Molecular weight | 234.72 g/mol |
| IUPAC name | tert-butyl N-(3-amino-1-bicyclo[1.1.1]pentanyl)carbamate;hydrochloride |
| InChIKey | JLRXEAFTXRCHPR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC12CC(C1)(C2)N.Cl |
Computed by PubChem (NCBI)