CAS 214628-89-4 appears in our catalog under these names: Methyl 5-amino-2-naphthoate, 97%, Methyl 5-amino-2-naphthoate, methyl 5-aminonaphthalene-2-carboxylate, 95%, 95%. Offered by: Chemat Brand, Biosynth, Chemat. Available pack sizes: on request, 1g, 10mg, 25mg.
Methyl 5-aminonaphthalene-2-carboxylate (CAS 214628-89-4) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: methyl 5-aminonaphthalene-2-carboxylate. InChIKey: FQINCIUCUPLHKP-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | methyl 5-aminonaphthalene-2-carboxylate |
| InChIKey | FQINCIUCUPLHKP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)C(=CC=C2)N |
Computed by PubChem (NCBI)