CAS 214759-65-6 is the registry number for 6-Cyano-4-chromanone, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
4-oxo-2,3-dihydrochromene-6-carbonitrile (CAS 214759-65-6) is a chemical compound with the molecular formula C10H7NO2 and a molecular weight of 173.17 g/mol. IUPAC name: 4-oxo-2,3-dihydrochromene-6-carbonitrile. InChIKey: FVBMSIFHHAWXLT-UHFFFAOYSA-N.
| Molecular formula | C10H7NO2 |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | 4-oxo-2,3-dihydrochromene-6-carbonitrile |
| InChIKey | FVBMSIFHHAWXLT-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1=O)C=C(C=C2)C#N |
Computed by PubChem (NCBI)