Products 2151859-09-3
CAS 2151859-09-3 is the registry number for 1-amino-3-(4-methoxybenzyl)-3-azabicyclo[3.1.1]heptane-2,4-dione. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
1-amino-3-[(4-methoxyphenyl)methyl]-3-azabicyclo[3.1.1]heptane-2,4-dione (CAS 2151859-09-3) is a chemical compound with the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. IUPAC name: 1-amino-3-[(4-methoxyphenyl)methyl]-3-azabicyclo[3.1.1]heptane-2,4-dione. InChIKey: LMMYTOSGDPZDBQ-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O3 |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | 1-amino-3-[(4-methoxyphenyl)methyl]-3-azabicyclo[3.1.1]heptane-2,4-dione |
| InChIKey | LMMYTOSGDPZDBQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CN2C(=O)C3CC(C3)(C2=O)N |
Computed by PubChem (NCBI)