CAS 2152663-73-3 appears in our catalog under these names: 1-Hydroxy-7-methyl-1,3-dihydrobenzo[c][1,2]oxaborole-6-carboxylic acid, 98%, 98%, 1-Hydroxy-7-methyl-1,3-dihydrobenzo[c][1,2]oxaborole-6-carboxylic acid, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 25mg, 50mg, 100mg, 250mg.
1-hydroxy-7-methyl-3H-2,1-benzoxaborole-6-carboxylic acid (CAS 2152663-73-3) is a chemical compound with the molecular formula C9H9BO4 and a molecular weight of 191.98 g/mol. IUPAC name: 1-hydroxy-7-methyl-3H-2,1-benzoxaborole-6-carboxylic acid. InChIKey: QCEXUFNUTJZPPS-UHFFFAOYSA-N.
| Molecular formula | C9H9BO4 |
|---|---|
| Molecular weight | 191.98 g/mol |
| IUPAC name | 1-hydroxy-7-methyl-3H-2,1-benzoxaborole-6-carboxylic acid |
| InChIKey | QCEXUFNUTJZPPS-UHFFFAOYSA-N |
| SMILES | B1(C2=C(CO1)C=CC(=C2C)C(=O)O)O |
Computed by PubChem (NCBI)