CAS 215309-00-5 appears in our catalog under these names: 3-Morpholinobenzoic acid, 98%, 3-Morpholinobenzoic acid, 97% , 3-Morpholinobenzoic acid 97%, 3-Morpholinobenzoic acid, 97%, 97%. Offered by: Combi-blocks, Thermo Scientific, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 1g, 5g, 250MG, 10g.
3-morpholin-4-ylbenzoic acid (CAS 215309-00-5) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: 3-morpholin-4-ylbenzoic acid. InChIKey: VSKFQESEPGOWBS-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | 3-morpholin-4-ylbenzoic acid |
| InChIKey | VSKFQESEPGOWBS-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)