CAS 2155852-93-8 appears in our catalog under these names: Ethyl 2-(4-chloropyridin-3-yl)acetate hydrochloride, 98%, Ethyl 2-(4-chloropyridin-3-yl)acetate hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.
Ethyl 2-(4-chloro-3-pyridinyl)acetate;hydrochloride (CAS 2155852-93-8) is a chemical compound with the molecular formula C9H11Cl2NO2 and a molecular weight of 236.09 g/mol. IUPAC name: ethyl 2-(4-chloro-3-pyridinyl)acetate;hydrochloride. InChIKey: WWWIURYENJGDKN-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2NO2 |
|---|---|
| Molecular weight | 236.09 g/mol |
| IUPAC name | ethyl 2-(4-chloro-3-pyridinyl)acetate;hydrochloride |
| InChIKey | WWWIURYENJGDKN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=C(C=CN=C1)Cl.Cl |
Computed by PubChem (NCBI)