Products 2155875-93-5
CAS 2155875-93-5 appears in our catalog under these names: 8-(Trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine, 95%, 95%, 8-(TRIFLUOROMETHYL)-[1,2,4]TRIAZOLO[1,5-A]PYRIDINE, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
8-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine (CAS 2155875-93-5) is a chemical compound with the molecular formula C7H4F3N3 and a molecular weight of 187.12 g/mol. IUPAC name: 8-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine. InChIKey: DDGNYEWIVFNCFB-UHFFFAOYSA-N.
| Molecular formula | C7H4F3N3 |
|---|---|
| Molecular weight | 187.12 g/mol |
| IUPAC name | 8-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine |
| InChIKey | DDGNYEWIVFNCFB-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=NC=N2)C(=C1)C(F)(F)F |
Computed by PubChem (NCBI)