CAS 21630-48-8 is the registry number for N2-Benzylpyridine-2,5-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 5g, 1g.
N-benzyl-5-nitropyridin-2-amine (CAS 21630-48-8) is a chemical compound with the molecular formula C12H11N3O2 and a molecular weight of 229.23 g/mol. IUPAC name: N-benzyl-5-nitropyridin-2-amine. InChIKey: DPOYSZDFYVXWFW-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O2 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | N-benzyl-5-nitropyridin-2-amine |
| InChIKey | DPOYSZDFYVXWFW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=NC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)