Products 2165756-87-4
CAS 2165756-87-4 appears in our catalog under these names: (2R)-2-{((tert-butoxy)carbonyl)amino}-2-(1-methylcyclopentyl)acetic acid, 97%, (2R)-2-{[(tert-butoxy)carbonyl]amino}-2-(1-methylcyclopentyl)acetic acid, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg.
(2R)-2-(1-methylcyclopentyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 2165756-87-4) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: (2R)-2-(1-methylcyclopentyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: ABBSKLJPIIRFMR-VIFPVBQESA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | (2R)-2-(1-methylcyclopentyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | ABBSKLJPIIRFMR-VIFPVBQESA-N |
| SMILES | CC1(CCCC1)[C@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)