CAS 2166-24-7 appears in our catalog under these names: Dimethyl pyridazine-3,6-dicarboxylate, 97%, 3,6-Dimethyl pyridazine-3,6-dicarboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 500mg.
Dimethyl pyridazine-3,6-dicarboxylate (CAS 2166-24-7) is a chemical compound with the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. IUPAC name: dimethyl pyridazine-3,6-dicarboxylate. InChIKey: HISONENHUFVHQN-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O4 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | dimethyl pyridazine-3,6-dicarboxylate |
| InChIKey | HISONENHUFVHQN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NN=C(C=C1)C(=O)OC |
Computed by PubChem (NCBI)